13680-35-8
| Name | 4,4'-Methylenebis(2,6-diethylaniline) |
| CAS | 13680-35-8 |
| EINECS(EC#) | 237-185-4 |
| Molecular Formula | C21H30N2 |
| MDL Number | MFCD00071552 |
| Molecular Weight | 310.48 |
| MOL File | 13680-35-8.mol |
Chemical Properties
| Appearance | Crystalline Powder |
| Melting point | 88-90 °C(lit.) |
| Boiling point | 205 °C / 0.5mmHg |
| density | 0.90 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 4.88±0.25(Predicted) |
| color | White to Almost white |
| Water Solubility | 440μg/L at 20℃ |
| Usage | LONZACURE(R) M-DEA is an excellent chain extender for polyurethanes (PU) and also a curing agent for epoxides (EP). It provides improved mechanical and dynamic properties which cannot be achieved with standard formulations. |
| InChI | InChI=1S/C21H30N2/c1-5-16-10-14(11-17(6-2)20(16)22)9-15-12-18(7-3)21(23)19(8-4)13-15/h10-13H,5-9,22-23H2,1-4H3 |
| InChIKey | NWIVYGKSHSJHEF-UHFFFAOYSA-N |
| SMILES | C(C1=CC(CC)=C(N)C(CC)=C1)C1=CC(CC)=C(N)C(CC)=C1 |
| LogP | 4.29 at 25℃ |
| CAS DataBase Reference | 13680-35-8(CAS DataBase Reference) |
| EPA Substance Registry System | 13680-35-8(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29215900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |