
13623-25-1
| Name | 6-Methoxy-1H-indanone |
| CAS | 13623-25-1 |
| EINECS(EC#) | 603-948-9 |
| Molecular Formula | C10H10O2 |
| MDL Number | MFCD00021232 |
| Molecular Weight | 162.19 |
| MOL File | 13623-25-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 105-109 °C (lit.) |
| Boiling point | 228.88°C (rough estimate) |
| density | 1.0281 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Fine Crystalline Powder |
| color | White to yellow |
| Usage | Indanone derivative as a1-adrenoceptor antagonist. |
| BRN | 1238602 |
| InChI | InChI=1S/C10H10O2/c1-12-8-4-2-7-3-5-10(11)9(7)6-8/h2,4,6H,3,5H2,1H3 |
| InChIKey | UJGDLLGKMWVCPT-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC(OC)=C2)CC1 |
| CAS DataBase Reference | 13623-25-1(CAS DataBase Reference) |