
134098-61-6
| Name | Fenpyroximate |
| CAS | 134098-61-6 |
| Molecular Formula | C24H27N3O4 |
| MDL Number | MFCD00274596 |
| Molecular Weight | 421.49 |
| MOL File | 134098-61-6.mol |
Chemical Properties
| Melting point | 101.1-102.4° |
| Boiling point | 546.2±60.0 °C(Predicted) |
| density | 1.25g/cm3 |
| storage temp. | Store at -20°C |
| solubility | Chloroform: Slightly soluble,Methanol: Slightly soluble |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 1.58±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Henry's Law Constant | 4.6×100 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Stability: | Light Sensitive |
| Major Application | agriculture environmental |
| InChI | 1S/C24H27N3O4/c1-17-21(22(27(5)26-17)30-20-9-7-6-8-10-20)15-25-29-16-18-11-13-19(14-12-18)23(28)31-24(2,3)4/h6-15H,16H2,1-5H3/b25-15+ |
| InChIKey | YYJNOYZRYGDPNH-MFKUBSTISA-N |
| SMILES | Cc1nn(C)c(Oc2ccccc2)c1\C=N\OCc3ccc(cc3)C(=O)OC(C)(C)C |
| LogP | 6.443 (est) |
| CAS DataBase Reference | 134098-61-6(CAS DataBase Reference) |
| EPA Substance Registry System | 134098-61-6(EPA Substance) |
Safety Data
| RIDADR | UN3082 (liquid) |
| WGK Germany | WGK 3 |
| HS Code | 29331990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1B |
| Hazardous Substances Data | 134098-61-6(Hazardous Substances Data) |
| Toxicity |