
133073-73-1
| Name | METHOTREXATE HYDRATE |
| CAS | 133073-73-1 |
| EINECS(EC#) | 200-413-8 |
| Molecular Formula | C20H22N8O5 |
| MDL Number | MFCD00150847 |
| Molecular Weight | 454.44 |
| MOL File | 133073-73-1.mol |
Chemical Properties
| Appearance | yellow to orange crystalline powder |
| Melting point | 195 °C |
| storage temp. | −20°C |
| solubility | H2O: insoluble |
| form | powder |
| color | yellow |
| biological source | synthetic (organic) |
| Optical Rotation | [α]/D +21.0±2.0° |
| Water Solubility | water: insoluble |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 3 months. |
| Major Application | metabolomics microbiology |
| InChIKey | FBOZXECLQNJBKD-ZDUSSCGKSA-N |
| SMILES | [H]O[H].CN(Cc1cnc2nc(N)nc(N)c2n1)c3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | MA1225000 |
| HS Code | 29339980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Repr. 1B Skin Irrit. 2 |