132843-44-8
| Name | Lithium Bis(pentafluoroethanesulfonyl)imide |
| CAS | 132843-44-8 |
| EINECS(EC#) | 686-525-1 |
| Molecular Formula | C4F10LiNO4S2 |
| MDL Number | MFCD22374096 |
| Molecular Weight | 387.102 |
| MOL File | 132843-44-8.mol |
Chemical Properties
| Melting point | 328°C(lit.) |
| form | powder to crystal |
| color | White to Almost white |
| Major Application | battery manufacturing battery manufacturing |
| InChI | InChI=1S/C4F10NO4S2.Li/c5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10;/q-1;+1 |
| InChIKey | ACFSQHQYDZIPRL-UHFFFAOYSA-N |
| SMILES | [Li+].[N-](S(C(F)(F)C(F)(F)F)(=O)=O)S(C(F)(F)C(F)(F)F)(=O)=O |
| CAS DataBase Reference | 132843-44-8 |
| EPA Substance Registry System | Ethanesulfonamide, 1,1,2,2,2-pentafluoro-N-[(pentafluoroethyl)sulfonyl]-, lithium salt (132843-44-8) |
Safety Data
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311-H314-H412 |
| Precautionary statements | P260-P264-P270-P273-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| RIDADR | 2923 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HazardClass | 8/6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |