
1291-32-3
| Name | Bis(cyclopentadienyl)zirconium dichloride |
| CAS | 1291-32-3 |
| EINECS(EC#) | 215-066-8 |
| Molecular Formula | C10H10Cl2Zr |
| MDL Number | MFCD00003726 |
| Molecular Weight | 292.32 |
| MOL File | 1291-32-3.mol |
Chemical Properties
| Appearance | White crystals. Soluble in polar organic solvents. Stable in dry air, very slowly hydrolyzes in moist air. |
| Melting point | 242-245 °C(lit.) |
| Boiling point | 124-125°C/15mm |
| Fp | 124-125°C/15mm |
| storage temp. | Refrigerator (+4°C) |
| form | Powder |
| color | white to off-white |
| Water Solubility | hydrolysis |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sensitive | Air & Moisture Sensitive |
| Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 |
| InChI | InChI=1S/2C5H5.2ClH.Zr/c2*1-2-4-5-3-1;;;/h2*1-5H;2*1H;/q;;;;+2/p-2 |
| InChIKey | QRUYYSPCOGSZGQ-UHFFFAOYSA-L |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Zr](Cl)Cl |^1:0,1,2,3,4,5,6,7,8,9| |
| Uses | |
| CAS DataBase Reference | 1291-32-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(cyclopentadienyl)zirconium dichloride(1291-32-3) |
| EPA Substance Registry System | 1291-32-3(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| RTECS | ZH7525000 |
| F | 8-10-21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Safety Profile |


