127512-29-2
| Name | DODAP |
| CAS | 127512-29-2 |
| Molecular Formula | C41H77NO4 |
| MDL Number | MFCD01321074 |
| Molecular Weight | 648.05 |
| MOL File | 127512-29-2.mol |
Chemical Properties
| Appearance | Light Yellow Oil |
| Boiling point | 670.1±55.0 °C(Predicted) |
| density | 0.916±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 8.02±0.28(Predicted) |
| color | Colourless to Light Yellow |
| Stability: | Light Sensitive; Hydroscopic; Store at -15 to -25°C |
| InChIKey | NYDLOCKCVISJKK-WRBBJXAJSA-N |
| SMILES | C(OC(=O)CCCCCCC/C=C\CCCCCCCC)(CN(C)C)COC(=O)CCCCCCC/C=C\CCCCCCCC |
Safety Data
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H331-H336-H351-H361d-H372 |
| Precautionary statements | P202-P301+P312-P302+P352-P304+P340+P311-P305+P351+P338-P308+P313 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Repr. 2 Skin Irrit. 2 STOT RE 1 Oral STOT SE 3 |