123312-89-0
| Name | Pymetrozine |
| CAS | 123312-89-0 |
| EINECS(EC#) | 200-258-5 |
| Molecular Formula | C10H11N5O |
| MDL Number | MFCD01632346 |
| Molecular Weight | 217.23 |
| MOL File | 123312-89-0.mol |
Chemical Properties
| Melting point | 234.4° |
| density | 1.36g/cm3 (20～25℃） |
| vapor pressure | 0Pa at 25.03℃ |
| Fp | >230 °C |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 12.90±0.40(Predicted) |
| color | White to Light Beige |
| BRN | 7814151 |
| Henry's Law Constant | 3.3×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability: | Hygroscopic |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C10H11N5O/c1-8-7-15(10(16)14-13-8)12-6-9-3-2-4-11-5-9/h2-6H,7H2,1H3,(H,14,16)/b12-6+ |
| InChIKey | QHMTXANCGGJZRX-WUXMJOGZSA-N |
| SMILES | CC1=NNC(=O)N(C1)\N=C\c2cccnc2 |
| LogP | -0.18 at 25℃ and pH7.1 |
| Surface tension | 69.4-72.3mN/m at 10g/L and 20℃ |
Safety Data
| Symbol(GHS) |   GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H351-H361fd-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | XZ3018620 |
| REACH Registrations | Active |
| HS Code | 29336990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Repr. 2 |
| Hazardous Substances Data | 123312-89-0(Hazardous Substances Data) |
| Toxicity |