
12245-39-5
| Name | ACETYLACETONATO(1,5-CYCLOOCTADIENE)RHODIUM(I) |
| CAS | 12245-39-5 |
| Molecular Formula | C13H19O2Rh |
| MDL Number | MFCD00075046 |
| Molecular Weight | 310.19 |
| MOL File | 12245-39-5.mol |
Chemical Properties
| Appearance | Orange crystal |
| Melting point | 138-140 °C(lit.) |
| storage temp. | below 5° C |
| form | Crystals |
| color | Yellow to orange |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 |
| InChI | 1S/C8H12.C5H8O2.Rh/c1-2-4-6-8-7-5-3-1;1-4(6)3-5(2)7;/h1-2,7-8H,3-6H2;3,6H,1-2H3;/q;;+1/p-1/b2-1-,8-7-;4-3-; |
| InChIKey | WDIAJTWVVLHUJU-SUESZSCISA-N |
| SMILES | CC(=O)\C=C(\C)O[Rh].C1CC=CCCC=C1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | VI9292000 |
| TSCA | No |
| REACH Registrations | Inactive |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| Safety Profile |

;