1217448-46-8
| Name | Doxercalciferol-D3 |
| CAS | 1217448-46-8 |
| Molecular Formula | C28H41D3O |
| MDL Number | MFCD11656674 |
| Molecular Weight | 399.667 |
| MOL File | 1217448-46-8.mol |
Chemical Properties
| Melting point | 114-118°C |
| Fp | 14 °C |
| storage temp. | -20°C |
| solubility | Soluble in DMSO |
| form | Powder |
| color | White to off-white |
| InChIKey | MECHNRXZTMCUDQ-PKHJTDEHNA-N |
| SMILES | C[C@]12CCC/C(=C\C(\[H])=C3\C[C@@H](O)CCC\3=C([H])[H])/[C@]1([H])CC[C@]2([H])[C@H](C)/C=C/[C@H](C)C(C)C |&1:1,11,19,23,25,29,r| |
| CAS Number Unlabeled | 50-14-6 |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P305+P351+P338 |
| Hazard Codes | T+,Xn,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution |
| WGK Germany | 2 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 3 Dermal Acute Tox. 3 Oral STOT RE 1 Oral |