1207456-00-5
| Name | BMN 673 (8R,9S) |
| CAS | 1207456-00-5 |
| Molecular Formula | C19H14F2N6O |
| MDL Number | MFCD25372032 |
| Molecular Weight | 380.35 |
| MOL File | 1207456-00-5.mol |
Chemical Properties
| density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | ≥38 mg/mL in DMSO with gentle warming; insoluble in H2O; ≥15.03 mg/mL in EtOH with gentle warming and ultrasonic |
| form | solid |
| pka | 10.14±0.60(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C19H14F2N6O/c1-27-18(22-8-23-27)15-16(9-2-4-10(20)5-3-9)24-13-7-11(21)6-12-14(13)17(15)25-26-19(12)28/h2-8,15-16,24H,1H3,(H,26,28)/t15-,16-/m0/s1 |
| InChIKey | HWGQMRYQVZSGDQ-HOTGVXAUSA-N |
| SMILES | C1(=O)C2=C3C(N[C@@H](C4=CC=C(F)C=C4)[C@H](C4N(C)N=CN=4)C3=NN1)=CC(F)=C2 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P302+P352 |