1205-64-7
| Name | 3-Methyldiphenylamine |
| CAS | 1205-64-7 |
| EINECS(EC#) | 214-885-8 |
| Molecular Formula | C13H13N |
| MDL Number | MFCD00008530 |
| Molecular Weight | 183.25 |
| MOL File | 1205-64-7.mol |
Chemical Properties
| Appearance | brown to black liquid after melting |
| Melting point | 30 °C |
| Boiling point | 315 °C/724 mmHg (lit.) |
| density | 1.066 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 0.97±0.30(Predicted) |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C13H13N/c1-11-6-5-9-13(10-11)14-12-7-3-2-4-8-12/h2-10,14H,1H3 |
| InChIKey | TWPMMLHBHPYSMT-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=CC(C)=C1 |
| CAS DataBase Reference | 1205-64-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1205-64-7(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |