
120-21-8
| Name | 4-Diethylaminobenzaldehyde |
| CAS | 120-21-8 |
| EINECS(EC#) | 204-377-4 |
| Molecular Formula | C11H15NO |
| MDL Number | MFCD00003382 |
| Molecular Weight | 177.24 |
| MOL File | 120-21-8.mol |
Chemical Properties
| Appearance | dark brown to green coarse crystals or |
| Melting point | 37-41 °C(lit.) |
| Boiling point | 174 °C7 mm Hg(lit.) |
| density | 1.03 g/cm3 |
| refractive index | 1.5302 (estimate) |
| Fp | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | 2.5g/l |
| form | Coarse Crystals, Chunks or Crystalline Solid |
| pka | 3.36±0.32(Predicted) |
| color | Brown to green to black |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC |
| BRN | 511102 |
| InChI | 1S/C11H15NO/c1-3-12(4-2)11-7-5-10(9-13)6-8-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | MNFZZNNFORDXSV-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)N(CC)CC |
| CAS DataBase Reference | 120-21-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H312-H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | CU5612850 |
| TSCA | Yes |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
