
118-97-8
Name | 4-Chloro-3,5-dinitrobenzoic acid |
CAS | 118-97-8 |
EINECS(EC#) | 204-290-1 |
Molecular Formula | C7H3ClN2O6 |
MDL Number | MFCD00007080 |
Molecular Weight | 246.56 |
MOL File | 118-97-8.mol |
Chemical Properties
Appearance | yellow crystals |
Melting point | 159-162 °C (lit.) |
Boiling point | 315°C |
density | 1.9543 (rough estimate) |
refractive index | 1.6500 (estimate) |
Fp | 186°C |
storage temp. | Sealed in dry,2-8°C |
solubility | soluble in Methanol |
form | powder to crystal |
pka | 2?+-.0.10(Predicted) |
color | Light orange to Yellow to Green |
BRN | 668253 |
InChI | InChI=1S/C7H3ClN2O6/c8-6-4(9(13)14)1-3(7(11)12)2-5(6)10(15)16/h1-2H,(H,11,12) |
InChIKey | PCTFIHOVQYYAMH-UHFFFAOYSA-N |
SMILES | C(O)(=O)C1=CC([N+]([O-])=O)=C(Cl)C([N+]([O-])=O)=C1 |
CAS DataBase Reference | 118-97-8(CAS DataBase Reference) |
EPA Substance Registry System | 118-97-8(EPA Substance) |
Safety Data
Hazard Codes | Xi |
Risk Statements | |
Safety Statements | |
WGK Germany | 3 |
Hazard Note | Irritant |
TSCA | Yes |
HS Code | 29163990 |