115035-46-6
| Name | H-GLY-PRO-AMC HBR |
| CAS | 115035-46-6 |
| Molecular Formula | C17H20BrN3O4 |
| MDL Number | MFCD00152092 |
| Molecular Weight | 410.26 |
| MOL File | 115035-46-6.mol |
Chemical Properties
| storage temp. | -20°C |
| solubility | DMF:10.0(Max Conc. mg/mL);24.37(Max Conc. mM) DMSO:1.0(Max Conc. mg/mL);2.44(Max Conc. mM) PBS (pH 7.2):10.0(Max Conc. mg/mL);24.37(Max Conc. mM) |
| form | A solid |
| color | Off-white to light yellow |
| Water Solubility | water: 50mg/mL, clear, colorless to light yellow |
| InChI | InChI=1/C17H19N3O4.BrH/c1-10-7-16(22)24-14-8-11(4-5-12(10)14)19-17(23)13-3-2-6-20(13)15(21)9-18;/h4-5,7-8,13H,2-3,6,9,18H2,1H3,(H,19,23);1H/t13-;/s3 |
| InChIKey | PASXTQMFJRHMLJ-PHCOUKOGNA-N |
| SMILES | C12C(C)=CC(=O)OC=1C=C(NC(=O)[C@@H]1CCCN1C(=O)CN)C=C2.Br |&1:13,r| |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |