1141-88-4
| Name | 2,2'-Diaminodiphenyl disulphide |
| CAS | 1141-88-4 |
| EINECS(EC#) | 214-529-1 |
| Molecular Formula | C12H12N2S2 |
| MDL Number | MFCD00007703 |
| Molecular Weight | 248.37 |
| MOL File | 1141-88-4.mol |
Chemical Properties
| Melting point | 91-92 °C(lit.) |
| Boiling point | 398.0±27.0 °C(Predicted) |
| density | 1.2716 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in hot methanol- almost transparent. |
| form | powder to crystal |
| pka | 2.81±0.10(Predicted) |
| color | Light yellow to Amber to Dark green |
| BRN | 914032 |
| InChI | InChI=1S/C12H12N2S2/c13-9-5-1-3-7-11(9)15-16-12-8-4-2-6-10(12)14/h1-8H,13-14H2 |
| InChIKey | YYYOQURZQWIILK-UHFFFAOYSA-N |
| SMILES | S(C1=CC=CC=C1N)SC1=CC=CC=C1N |
| CAS DataBase Reference | 1141-88-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,2'-dithiobis-(1141-88-4) |
| EPA Substance Registry System | 1141-88-4(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H319-H410 |
| Precautionary statements | P273-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all |
| WGK Germany | 2 |
| RTECS | BX9540000 |
| F | 10-23 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| Safety Profile | |
| Toxicity |