
1133-80-8
| Name | 2-Bromofluorene |
| CAS | 1133-80-8 |
| EINECS(EC#) | 214-480-6 |
| Molecular Formula | C13H9Br |
| MDL Number | MFCD00001115 |
| Molecular Weight | 245.11 |
| MOL File | 1133-80-8.mol |
Chemical Properties
| Appearance | white to slightly yellow crystalline powder |
| Melting point | 112-114 °C (lit.) |
| Boiling point | 185 °C/135 mmHg (lit.) |
| density | 1.4187 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| Fp | 185°C/135mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and ethyl acetate. |
| form | Slightly Crystalline Powder or Flakes |
| color | White to slightly yellow |
| BRN | 1946701 |
| InChI | InChI=1S/C13H9Br/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | FXSCJZNMWILAJO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C2=C1C=C(Br)C=C2 |
| CAS DataBase Reference | 1133-80-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 9H-Fluorene, 2-bromo-(1133-80-8) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29039900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
