113-92-8
| Name | Chlorpheniramine maleate |
| CAS | 113-92-8 |
| EINECS(EC#) | 205-054-0 |
| Molecular Formula | C20H23ClN2O4 |
| MDL Number | MFCD00069225 |
| Molecular Weight | 390.86 |
| MOL File | 113-92-8.mol |
Chemical Properties
| Appearance | White Solid |
| Melting point | 130-135 °C(lit.) |
| alpha | -1～+1°(D/20℃)(c=5,DMF) |
| density | 1.1984 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| Fp | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | Freely soluble in water, soluble in ethanol (96 per cent) |
| form | neat |
| color | White to Almost white |
| Odor | odorless |
| PH | 4.0～5.5 (10g/l, 25℃) |
| Water Solubility | 1-5 g/100 mL at 21 ºC |
| Merck | 14,2180 |
| BCS Class | 3/1 |
| InChI | 1S/C16H19ClN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | DBAKFASWICGISY-BTJKTKAUSA-N |
| SMILES | CN(C)CCC(C1=CC=C(Cl)C=C1)C2=NC=CC=C2.O=C(/C=C\C(O)=O)O |
| LogP | 3.389 (est) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | T,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | US6504000 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Safety Profile | |
| Properties | Weight-percent of components: 1.96 wt% palladium acetate 7.17 wt% phosphine ligand 90.8 wt% potassium phosphate |
| Toxicity |
