
1129-30-2
| Name | 2,6-Diacetylpyridine |
| CAS | 1129-30-2 |
| EINECS(EC#) | 214-442-9 |
| Molecular Formula | C9H9NO2 |
| MDL Number | MFCD00006304 |
| Molecular Weight | 163.17 |
| MOL File | 1129-30-2.mol |
Chemical Properties
| Appearance | white to off-white crystalline needles or powder |
| Melting point | 79-82 °C (lit.) |
| Boiling point | 126 °C / 6mmHg |
| density | 1.2021 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Needles or Powder |
| pka | 0.88±0.10(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in water, chloroform, and DMSO. |
| Detection Methods | GC,NMR |
| BRN | 118286 |
| InChI | InChI=1S/C9H9NO2/c1-6(11)8-4-3-5-9(10-8)7(2)12/h3-5H,1-2H3 |
| InChIKey | BEZVGIHGZPLGBL-UHFFFAOYSA-N |
| SMILES | C1(C(=O)C)=NC(C(=O)C)=CC=C1 |
| LogP | 1.319 (est) |
| CAS DataBase Reference | 1129-30-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
