1113-21-9
| Name | Geranyl linalool |
| CAS | 1113-21-9 |
| EINECS(EC#) | 214-201-8 |
| Molecular Formula | C20H34O |
| MDL Number | MFCD00059363 |
| Molecular Weight | 290.48 |
| MOL File | 1113-21-9.mol |
Chemical Properties
| Appearance | clear colourless to pale yellowish liquid |
| Boiling point | 250 °C |
| density | 0.885 g/mL at 20 °C(lit.) |
| refractive index | n |
| Fp | 160°C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Liquid |
| pka | 14.40±0.29(Predicted) |
| color | Clear colorless to pale yellow |
| Odor | at 100.00 %. mild floral rose balsam |
| Odor Type | floral |
| Water Solubility | insoluble |
| BRN | 6713421 |
| Stability: | Light Sensitive |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C20H34O/c1-7-20(6,21)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h7,11,13,15,21H,1,8-10,12,14,16H2,2-6H3/b18-13+,19-15+ |
| InChIKey | IQDXAJNQKSIPGB-HQSZAHFGSA-N |
| SMILES | C\C(C)=C/CC\C(C)=C\CC\C(C)=C\CCC(C)(O)C=C |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | MM0335000 |
| F | 10 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29052200 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |