109037-75-4
| Name | Triarylsulfonium hexafluoroantimonate salts， mixed |
| CAS | 109037-75-4 |
| Molecular Formula | C30H51F6SSb |
| MDL Number | MFCD00197940 |
| Molecular Weight | 679.541 |
| MOL File | 109037-75-4.mol |
Chemical Properties
| Boiling point | >220 °C |
| density | 1.410 g/mL at 25 °C |
| refractive index | n |
| Fp | >230 °F |
| InChIKey | IAYXUSLCQRDSMB-KXRZBFRONA-H |
| SMILES | [S+](C12C(C)(C)C1CCC(C)C2)(C12C(C)(C)C1CCC(C)C2)[C@@]12C(C)(C)C1CCC(C)C2.[Sb-](F)(F)(F)(F)(F)F |&1:21,r| |
| EPA Substance Registry System | Benzene, reaction products with chlorine and sulfur chloride (S2Cl2), hexafluoroantimonates(1-) (109037-75-4) |
Safety Data
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H332-H319-H411 |
| Precautionary statements | P261-P264-P273-P301+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 |