107890-32-4
| Name | 1-(4-(TRIFLUOROMETHYL)BENZYL)PIPERAZINE& |
| CAS | 107890-32-4 |
| Molecular Formula | C12H15F3N2 |
| MDL Number | MFCD03407490 |
| Molecular Weight | 244.26 |
| MOL File | 107890-32-4.mol |
Chemical Properties
| Boiling point | 88-89 °C0.02 mm Hg |
| density | 1.239 g/mL at 25 °C |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 9.07±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | 1S/C12H15F3N2/c13-12(14,15)11-3-1-10(2-4-11)9-17-7-5-16-6-8-17/h1-4,16H,5-9H2 |
| InChIKey | FAFAFWFQFVLXGF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(CN2CCNCC2)cc1 |
Safety Data
| Hazard Codes | Xn,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| HS Code | 2933.59.8000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |