
105-90-8
| Name | GERANYL PROPIONATE |
| CAS | 105-90-8 |
| EINECS(EC#) | 203-344-1 |
| Molecular Formula | C13H22O2 |
| MDL Number | MFCD00027009 |
| Molecular Weight | 210.31 |
| MOL File | 105-90-8.mol |
Chemical Properties
| Appearance | Colorless liquid; roselike odor. Soluble in most oils; insoluble in glycerol. Combustible. |
| Boiling point | 252 °C738 mm Hg(lit.) |
| density | 0.899 g/mL at 25 °C(lit.) |
| vapor pressure | 3.09Pa at 25℃ |
| FEMA | 2517 |
| refractive index | n |
| Fp | >230 °F |
| solubility | 0.9% soluble in water, almost insoluble in alcohol and oils. About 5% soluble in hot water |
| color | White or colorless plate-like crystals |
| Odor | at 100.00 %. floral fresh waxy fruity rose tropical citrus geranium powdery |
| biological source | synthetic |
| Odor Type | floral |
| Water Solubility | 2.22mg/L at 25℃ |
| JECFA Number | 62 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H22O2/c1-5-13(14)15-10-9-12(4)8-6-7-11(2)3/h7,9H,5-6,8,10H2,1-4H3/b12-9+ |
| InChIKey | BYCHQEILESTMQU-FMIVXFBMSA-N |
| SMILES | CCC(=O)OC\C=C(/C)CC\C=C(\C)C |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P304+P340+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | RG5927906 |
| TSCA | TSCA listed |
| REACH Registrations | Inactive |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Safety Profile | |
| Toxicity |
