
10485-09-3
| Name | 2-Bromoindene |
| CAS | 10485-09-3 |
| EINECS(EC#) | 678-249-5 |
| Molecular Formula | C9H7Br |
| MDL Number | MFCD06797863 |
| Molecular Weight | 195.06 |
| MOL File | 10485-09-3.mol |
Chemical Properties
| Appearance | Yellow to pale brown low melting solid |
| Melting point | 35-37°C |
| Boiling point | 127 °C / 23mmHg |
| density | 1.570±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C9H7Br/c10-9-5-7-3-1-2-4-8(7)6-9/h1-5H,6H2 |
| InChIKey | CCUYEVNCRQDQRF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C=C1Br |
| CAS DataBase Reference | 10485-09-3(CAS DataBase Reference) |