1048-05-1
| Name | TETRAPHENYLGERMANE |
| CAS | 1048-05-1 |
| EINECS(EC#) | 213-880-8 |
| Molecular Formula | C24H20Ge |
| MDL Number | MFCD00002997 |
| Molecular Weight | 381.06 |
| MOL File | 1048-05-1.mol |
Chemical Properties
| Appearance | White crystalline powder |
| Melting point | 230-235 °C (lit.) |
| Boiling point | >400°C |
| refractive index | 1.5800 |
| storage temp. | RT, protect from light, stored under nitrogen |
| form | solid |
| color | White to Almost white |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C24H20Ge/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | ILEXMONMGUVLRM-UHFFFAOYSA-N |
| SMILES | [Ge](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 1048-05-1(CAS DataBase Reference) |
| EPA Substance Registry System | Germane, tetraphenyl- (1048-05-1) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| TSCA | Yes |
| HS Code | 2931.90.6000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |