10421-85-9
| Name | 2-Chloromandelic acid |
| CAS | 10421-85-9 |
| EINECS(EC#) | 233-900-9 |
| Molecular Formula | C8H7ClO3 |
| MDL Number | MFCD00084962 |
| Molecular Weight | 186.59 |
| MOL File | 10421-85-9.mol |
Chemical Properties
| Appearance | White to pale cream crystalline powder |
| Melting point | 90-93 °C(lit.) |
| Boiling point | 266.91°C (rough estimate) |
| density | 1.3245 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Sonicated), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 3.30±0.10(Predicted) |
| color | White to pale cream |
| Water Solubility | Very soluble in water. |
| BRN | 2367070 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H7ClO3/c9-6-4-2-1-3-5(6)7(10)8(11)12/h1-4,7,10H,(H,11,12) |
| InChIKey | RWOLDZZTBNYTMS-UHFFFAOYSA-N |
| SMILES | C(C1C=CC=CC=1Cl)(O)C(=O)O |
| CAS DataBase Reference | 10421-85-9(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
