104-03-0
| Name | 4-Nitrophenylacetic acid |
| CAS | 104-03-0 |
| EINECS(EC#) | 203-168-5 |
| Molecular Formula | C8H7NO4 |
| MDL Number | MFCD00007383 |
| Molecular Weight | 181.15 |
| MOL File | 104-03-0.mol |
Chemical Properties
| Appearance | Beige to yellow crystalline powder |
| Melting point | 150-155 °C(lit.) |
| Boiling point | 314.24°C (rough estimate) |
| density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 3.85(at 25℃) |
| color | Beige to yellow |
| PH | 2.98 at 22.8℃ and 10g/L |
| Water Solubility | slightly soluble |
| Merck | 14,6622 |
| BRN | 1911801 |
| InChI | 1S/C8H7NO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,10,11) |
| InChIKey | YBADLXQNJCMBKR-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccc(cc1)[N+]([O-])=O |
| LogP | 0.3 at 30℃ and pH7.72 |
| Uses | |
| CAS DataBase Reference | 104-03-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H318-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P391-P501 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | AJ1130010 |
| Hazard Note | Irritant |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29163900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 |
| Toxicity |