10386-27-3
| Name | 2-Bromo-4-cyanopyridine |
| CAS | 10386-27-3 |
| Molecular Formula | C6H3BrN2 |
| MDL Number | MFCD07367879 |
| Molecular Weight | 183.01 |
| MOL File | 10386-27-3.mol |
Chemical Properties
| Melting point | 78-80°C |
| Boiling point | 243.4±20.0 °C(Predicted) |
| density | 1.72±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -2.56±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/C6H3BrN2/c7-6-3-5(4-8)1-2-9-6/h1-3H |
| InChIKey | AWSJFEKOXQBDSL-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(C#N)=C1 |
| CAS DataBase Reference | 10386-27-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280h-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3439 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |