
1034-01-1
| Name | Octyl gallate |
| CAS | 1034-01-1 |
| EINECS(EC#) | 213-853-0 |
| Molecular Formula | C15H22O5 |
| MDL Number | MFCD00002197 |
| Molecular Weight | 282.33 |
| MOL File | 1034-01-1.mol |
Chemical Properties
| Melting point | 101-104 °C(lit.) |
| Boiling point | 262.5°C (estimate) |
| density | 1.0984 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 0-6°C |
| solubility | soluble2.5%, clear, colorless (AcOH (MEOH)) |
| form | neat |
| pka | 7.94±0.25(Predicted) |
| color | White to Off-White |
| Water Solubility | 20mg/L(29.99 ºC) |
| BRN | 2132305 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C15H22O5/c1-2-3-4-5-6-7-8-20-15(19)11-9-12(16)14(18)13(17)10-11/h9-10,16-18H,2-8H2,1H3 |
| Contact allergens | |
| InChIKey | NRPKURNSADTHLJ-UHFFFAOYSA-N |
| SMILES | C(OCCCCCCCC)(=O)C1=CC(O)=C(O)C(O)=C1 |
| LogP | 3.660 |
| Uses |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| RTECS | LW8225000 |
| TSCA | Yes |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| Safety Profile | |
| Toxicity |