
103361-09-7
| Name | FLUMIOXAZIN |
| CAS | 103361-09-7 |
| Molecular Formula | C19H15FN2O4 |
| MDL Number | MFCD01754256 |
| Molecular Weight | 354.33 |
| MOL File | 103361-09-7.mol |
Chemical Properties
| Melting point | 201.83-203.83° |
| Boiling point | 644.4±55.0 °C(Predicted) |
| density | d20 1.5132 g/ml |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated) |
| form | neat |
| pka | -0.01±0.20(Predicted) |
| color | White to off-white |
| Henry's Law Constant | 1.6×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C19H15FN2O4/c1-2-7-21-15-9-14(13(20)8-16(15)26-10-17(21)23)22-18(24)11-5-3-4-6-12(11)19(22)25/h1,8-9H,3-7,10H2 |
| InChIKey | FOUWCSDKDDHKQP-UHFFFAOYSA-N |
| SMILES | Fc1cc2OCC(=O)N(CC#C)c2cc1N3C(=O)C4=C(CCCC4)C3=O |
| LogP | 2.550 |
| EPA Substance Registry System | Flumioxazin (103361-09-7) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360D-H410 |
| Precautionary statements | P201-P273-P308+P313 |
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 |
| Hazardous Substances Data | 103361-09-7(Hazardous Substances Data) |
| Toxicity |

