102308-32-7
| Name | (S)-(-)-3-TERT-BUTOXYCARBONYL-4-FORMYL-2,2-DIMETHYL-1,3-OXAZOLIDINE |
| CAS | 102308-32-7 |
| Molecular Formula | C11H19NO4 |
| MDL Number | MFCD00209557 |
| Molecular Weight | 229.27 |
| MOL File | 102308-32-7.mol |
Chemical Properties
| Appearance | Clear colorless to yellow oil |
| alpha | D -91.7° (c = 1.34 in CHCl3) |
| Boiling point | 83-88 °C1 mm Hg(lit.) |
| density | 1.06 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 226 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | -3.26±0.60(Predicted) |
| color | Clear colorless to yellow |
| Optical Rotation | [α]20/D 90°, c = 1 in chloroform |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Air Sensitive |
| BRN | 3591324 |
| InChI | 1S/C11H19NO4/c1-10(2,3)16-9(14)12-8(6-13)7-15-11(12,4)5/h6,8H,7H2,1-5H3/t8-/m1/s1 |
| InChIKey | PNJXYVJNOCLJLJ-MRVPVSSYSA-N |
| SMILES | [H]C(=O)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| CAS DataBase Reference | 102308-32-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
