101187-40-0
| Name | 5,8,11-Trioxa-2-azatridecanoic,13-amino,1,1-dimethylethyl ester |
| CAS | 101187-40-0 |
| Molecular Formula | C13H28N2O5 |
| MDL Number | MFCD11975204 |
| Molecular Weight | 292.37 |
| MOL File | 101187-40-0.mol |
Chemical Properties
| Boiling point | 405.7±35.0 °C(Predicted) |
| density | 1.050 |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Soluble in Water, DMSO, DCM, DMF |
| form | clear liquid to cloudy liquid |
| pka | 12.23±0.46(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C13H28N2O5/c1-13(2,3)20-12(16)15-5-7-18-9-11-19-10-8-17-6-4-14/h4-11,14H2,1-3H3,(H,15,16) |
| InChIKey | CUPBLDPRUBNAIE-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCOCCN |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2924190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
