
101-70-2
| Name | 4,4'-DIMETHOXYDIPHENYLAMINE |
| CAS | 101-70-2 |
| EINECS(EC#) | 202-968-1 |
| Molecular Formula | C14H15NO2 |
| MDL Number | MFCD00014895 |
| Molecular Weight | 229.27 |
| MOL File | 101-70-2.mol |
Chemical Properties
| Appearance | silver-grey crystalline solid |
| Melting point | 101-102°C |
| Boiling point | 371.18°C (rough estimate) |
| density | 1.0955 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.16±0.40(Predicted) |
| color | Off-White to Light Brown |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 2214262 |
| InChI | 1S/C14H15NO2/c1-16-13-7-3-11(4-8-13)15-12-5-9-14(17-2)10-6-12/h3-10,15H,1-2H3 |
| InChIKey | VCOONNWIINSFBA-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(OC)cc2)cc1 |
| CAS DataBase Reference | 101-70-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Di-(4-methoxy phenyl) amine(101-70-2) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H351 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DU9085000 |
| TSCA | Yes |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |

