
101-26-8
| Name | Mestinon |
| CAS | 101-26-8 |
| EINECS(EC#) | 202-929-9 |
| Molecular Formula | C9H13BrN2O2 |
| MDL Number | MFCD00079283 |
| Molecular Weight | 261.12 |
| MOL File | 101-26-8.mol |
Chemical Properties
| Melting point | 154 °C |
| storage temp. | 2-8°C |
| solubility | Very soluble in water and in ethanol (96 per cent). |
| form | neat |
| color | White to Almost white |
| Merck | 7977 |
| BCS Class | 3 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C9H13N2O2.BrH/c1-10(2)9(12)13-8-5-4-6-11(3)7-8;/h4-7H,1-3H3;1H/q+1;/p-1 |
| InChIKey | VNYBTNPBYXSMOO-UHFFFAOYSA-M |
| SMILES | C1(C=CC=[N+](C)C=1)OC(=O)N(C)C.[Br-] |
| CAS DataBase Reference | 101-26-8(CAS DataBase Reference) |
| EPA Substance Registry System | Pyridinium, 3-[[(dimethylamino)carbonyl]oxy]-1-methyl-, bromide (1:1) (101-26-8) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H317 |
| Precautionary statements | P262-P280-P301+P310+P330-P302+P352+P310-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | UU5270000 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 2933399090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 2 Dermal Acute Tox. 2 Oral Skin Sens. 1 |
| Hazardous Substances Data | 101-26-8(Hazardous Substances Data) |
| Toxicity |
