
10083-24-6
| Name | PICEATANNOL |
| CAS | 10083-24-6 |
| EINECS(EC#) | 600-132-4 |
| Molecular Formula | C14H12O4 |
| MDL Number | MFCD00221715 |
| Molecular Weight | 244.24 |
| MOL File | 10083-24-6.mol |
Chemical Properties
| Appearance | yellow to golden or green crystalline powder |
| Melting point | 223-227 °C |
| Boiling point | 108°C/0.04mmHg(lit.) |
| density | 1.1245 (rough estimate) |
| refractive index | 1.5190 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.5 mg/mL |
| form | powder |
| pka | 9.17±0.10(Predicted) |
| color | light tan to yellow |
| Water Solubility | H2O: 0.5mg/mL DMSO: 10mg/mL ethanol: 10mg/mL |
| λmax | 323nm(MeOH)(lit.) |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 2 months. |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1+ |
| InChIKey | CDRPUGZCRXZLFL-OWOJBTEDSA-N |
| SMILES | C1(O)=CC=C(/C=C/C2=CC(O)=CC(O)=C2)C=C1O |
| LogP | 2.690 (est) |