10040-98-9
| Name | 4-(1H-Imidazol-1-yl)benzaldehyde |
| CAS | 10040-98-9 |
| Molecular Formula | C10H8N2O |
| MDL Number | MFCD00209977 |
| Molecular Weight | 172.18 |
| MOL File | 10040-98-9.mol |
Chemical Properties
| Melting point | 153-155 °C(lit.) |
| Boiling point | 351.1±25.0 °C(Predicted) |
| density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.07±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| Detection Methods | HPLC |
| InChI | InChI=1S/C10H8N2O/c13-7-9-1-3-10(4-2-9)12-6-5-11-8-12/h1-8H |
| InChIKey | DCICUQFMCRPKHZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N2C=NC=C2)C=C1 |
| CAS DataBase Reference | 10040-98-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
